ChemNet > CAS > 21278-86-4 2-(4-Pyridyl)thiazole-4-carboxylic acid
21278-86-4 2-(4-Pyridyl)thiazole-4-carboxylic acid
Naam product |
2-(4-Pyridyl)thiazole-4-carboxylic acid |
Synoniemen |
2-(4-Pyridyl)-1,3-thiazole-4-carboxylic acid; 2-(pyridin-4-yl)-1,3-thiazole-4-carboxylic acid; 2-pyridin-4-yl-1,3-thiazole-4-carboxylate |
MF |
C9H5N2O2S |
Molecuulgewicht |
205.2137 |
InChI |
InChI=1/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-1-3-10-4-2-6/h1-5H,(H,12,13)/p-1 |
CAS-nummer |
21278-86-4 |
Moleculaire Structuur |
|
Smeltpunt |
300℃ |
Kookpunt |
469.3°C at 760 mmHg |
Vlampunt |
237.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|