ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
Naam product |
Methyl 3,4-dihydroxybenzoate |
Synoniemen |
3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
MF |
C8H8O4 |
Molecuulgewicht |
168.1467 |
InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
CAS-nummer |
2150-43-8 |
Moleculaire Structuur |
|
Dichtheid |
1.354g/cm3 |
Kookpunt |
351.5°C at 760 mmHg |
Brekingsindex |
1.587 |
Vlampunt |
148.5°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|