ChemNet > CAS > 22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
Naam product |
5-Acetamido-2-bromobenzoic acid hydrate |
Synoniemen |
5-(acetylamino)-2-bromobenzoic acid; 5-(acetylamino)-2-bromobenzoate |
MF |
C9H7BrNO3 |
Molecuulgewicht |
257.0613 |
InChI |
InChI=1/C9H8BrNO3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)/p-1 |
CAS-nummer |
22921-67-1 |
Moleculaire Structuur |
|
Smeltpunt |
186℃ |
Kookpunt |
466°C at 760 mmHg |
Vlampunt |
235.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|