ChemNet > CAS > 2619-88-7 Palmiticacidhydrazide
2619-88-7 Palmiticacidhydrazide
Naam product |
Palmiticacidhydrazide |
Synoniemen |
Hexadecanehydrazide; hexadecanoic acid, hydrazide |
MF |
C16H34N2O |
Molecuulgewicht |
270.454 |
InChI |
InChI=1/C16H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18-17/h2-15,17H2,1H3,(H,18,19) |
CAS-nummer |
2619-88-7 |
Moleculaire Structuur |
|
Dichtheid |
0.894g/cm3 |
Kookpunt |
416.2°C at 760 mmHg |
Brekingsindex |
1.463 |
Vlampunt |
205.5°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|