CAS No: 41411-61-4;26601-64-9, Chemical Name: 2,2',3,4,5,6-hexachlorobiphenyl
the physical and chemical property of 41411-61-4;26601-64-9, 2,2',3,4,5,6-hexachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 41411-61-4;26601-64-9 2,2',3,4,5,6-hexachlorobiphenyl
41411-61-4;26601-64-9 2,2',3,4,5,6-hexachlorobiphenyl
| Naam product |
2,2',3,4,5,6-hexachlorobiphenyl |
| Synoniemen |
1,1'-biphenyl, 2,2',3,4,5,6-hexachloro-; 2,2',3,4,5,6-Hexachloro-1,1'-biphenyl; 2,2',3,4,5,6-PCB; 41411-61-4 |
| MF |
C12H4Cl6 |
| Molecuulgewicht |
360.8782 |
| InChI |
InChI=1/C12H4Cl6/c13-6-4-2-1-3-5(6)7-8(14)10(16)12(18)11(17)9(7)15/h1-4H |
| CAS-nummer |
41411-61-4;26601-64-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.593g/cm3 |
| Kookpunt |
383.8°C at 760 mmHg |
| Brekingsindex |
1.626 |
| Vlampunt |
184°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
