ChemNet > CAS > 279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
279261-89-1 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid
Naam product |
3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
Synoniemen |
Boronic acid,B-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)- |
MF |
C9H11BO4 |
Molecuulgewicht |
193.9922 |
InChI |
InChI=1/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2 |
CAS-nummer |
279261-89-1 |
Moleculaire Structuur |
|
Dichtheid |
1.29g/cm3 |
Smeltpunt |
133℃ |
Kookpunt |
371°C at 760 mmHg |
Brekingsindex |
1.563 |
Vlampunt |
178.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|