ChemNet > CAS > 28036-91-1 3,4-dichlorobenzene-1-carbohydrazide
28036-91-1 3,4-dichlorobenzene-1-carbohydrazide
Naam product |
3,4-dichlorobenzene-1-carbohydrazide |
Synoniemen |
3,4-dichlorobenzohydrazide |
MF |
C7H6Cl2N2O |
Molecuulgewicht |
205.0413 |
InChI |
InChI=1/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,10H2,(H,11,12) |
CAS-nummer |
28036-91-1 |
Moleculaire Structuur |
|
Dichtheid |
1.455g/cm3 |
Smeltpunt |
152℃ |
Brekingsindex |
1.605 |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|