ChemNet > CAS > 2832-10-2 Ethyl 4-acetyl-5-oxohexanoate
2832-10-2 Ethyl 4-acetyl-5-oxohexanoate
Naam product |
Ethyl 4-acetyl-5-oxohexanoate |
Synoniemen |
Ethyl 4,4-diacetylbutyrate; 4-Acetyl-5-oxohexanoic acid ethyl ester; 2-(Ethoxycarbonylethyl)acetylacetone~Ethyl 4,4-diacetylbutyrate; ethyl (4E)-4-acetyl-5-hydroxyhex-4-enoate |
MF |
C10H16O4 |
Molecuulgewicht |
200.2316 |
InChI |
InChI=1/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h11H,4-6H2,1-3H3/b9-7+ |
CAS-nummer |
2832-10-2 |
Moleculaire Structuur |
|
Dichtheid |
1.082g/cm3 |
Kookpunt |
314.6°C at 760 mmHg |
Brekingsindex |
1.468 |
Vlampunt |
117.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|