ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
Naam product |
1,2,4-Trivinylcyclohexane, mixture of isomers |
Synoniemen |
cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
MF |
C12H18 |
Molecuulgewicht |
162.2713 |
InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
CAS-nummer |
2855-27-8 |
EINECS |
220-668-9 |
Moleculaire Structuur |
|
Dichtheid |
0.96g/cm3 |
Kookpunt |
198.4°C at 760 mmHg |
Brekingsindex |
1.628 |
Vlampunt |
68.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|