ChemNet > CAS > 286-62-4 Cyclooctene oxide
286-62-4 Cyclooctene oxide
| Naam product |
Cyclooctene oxide |
| Synoniemen |
9-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane; (1R,8S)-9-oxabicyclo[6.1.0]nonane; (1R,8R)-9-oxabicyclo[6.1.0]nonane; (1S,8S)-9-oxabicyclo[6.1.0]nonane |
| MF |
C8H14O |
| Molecuulgewicht |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS-nummer |
286-62-4 |
| EINECS |
206-010-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.958g/cm3 |
| Smeltpunt |
53-56℃ |
| Kookpunt |
189.3°C at 760 mmHg |
| Brekingsindex |
1.466 |
| Vlampunt |
56.1°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
