ChemNet > CAS > 300541-91-7 4-morpholino-3-nitrobenzaldehyde
300541-91-7 4-morpholino-3-nitrobenzaldehyde
Naam product |
4-morpholino-3-nitrobenzaldehyde |
Synoniemen |
4-morpholin-4-yl-3-nitrobenzaldehyde |
MF |
C11H12N2O4 |
Molecuulgewicht |
236.224 |
InChI |
InChI=1/C11H12N2O4/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2 |
CAS-nummer |
300541-91-7 |
Moleculaire Structuur |
|
Dichtheid |
1.34g/cm3 |
Smeltpunt |
53℃ |
Kookpunt |
431.6°C at 760 mmHg |
Brekingsindex |
1.613 |
Vlampunt |
214.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|