ChemNet > CAS > 313350-36-6 6-morpholinonicotinoyl chloride
313350-36-6 6-morpholinonicotinoyl chloride
Naam product |
6-morpholinonicotinoyl chloride |
Synoniemen |
6-morpholin-4-ylpyridine-3-carbonyl chloride |
MF |
C10H11ClN2O2 |
Molecuulgewicht |
226.6595 |
InChI |
InChI=1/C10H11ClN2O2/c11-10(14)8-1-2-9(12-7-8)13-3-5-15-6-4-13/h1-2,7H,3-6H2 |
CAS-nummer |
313350-36-6 |
Moleculaire Structuur |
|
Dichtheid |
1.314g/cm3 |
Smeltpunt |
122℃ |
Kookpunt |
400.9°C at 760 mmHg |
Brekingsindex |
1.568 |
Vlampunt |
196.3°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|