ChemNet > CAS > 31680-07-6 Methylnitrobenzaldehyde
31680-07-6 Methylnitrobenzaldehyde
Naam product |
Methylnitrobenzaldehyde |
Synoniemen |
4-Methyl-3-nitrobenzaldehyde; Benzaldehyde, 4-methyl-3-nitro-; WLN IS WNR B1 EVH [WLN] |
MF |
C8H7NO3 |
Molecuulgewicht |
165.1461 |
InChI |
InChI=1/C8H7NO3/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-5H,1H3 |
CAS-nummer |
31680-07-6 |
EINECS |
250-760-4 |
Moleculaire Structuur |
|
Dichtheid |
1.278g/cm3 |
Smeltpunt |
43-54℃ |
Kookpunt |
276.3°C at 760 mmHg |
Brekingsindex |
1.602 |
Vlampunt |
130.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|