ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
Naam product |
2,2-dimethyl-2H-chromene-6-carbonitrile |
Synoniemen |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
MF |
C12H11NO |
Molecuulgewicht |
185.2218 |
InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
CAS-nummer |
33143-29-2 |
Moleculaire Structuur |
|
Dichtheid |
1.13g/cm3 |
Smeltpunt |
48℃ |
Kookpunt |
301°C at 760 mmHg |
Brekingsindex |
1.578 |
Vlampunt |
126.8°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|