ChemNet > CAS > 3414-94-6 3-Phenyl-1,2,4-triazole-5-thiol hydrate
3414-94-6 3-Phenyl-1,2,4-triazole-5-thiol hydrate
Naam product |
3-Phenyl-1,2,4-triazole-5-thiol hydrate |
Synoniemen |
5-phenyl-1H-1,2,4-triazole-3-thiol; 5-phenyl-4H-1,2,4-triazole-3-thiol |
MF |
C8H7N3S |
Molecuulgewicht |
177.2263 |
InChI |
InChI=1/C8H7N3S/c12-8-9-7(10-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11,12) |
CAS-nummer |
3414-94-6 |
Moleculaire Structuur |
|
Dichtheid |
1.39g/cm3 |
Smeltpunt |
253-255℃ |
Kookpunt |
267.8°C at 760 mmHg |
Brekingsindex |
1.731 |
Vlampunt |
115.8°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|