3887-02-3 N-methylmethacrylamide
Naam product |
N-methylmethacrylamide |
Synoniemen |
N-methylmethacrylamide; N-methylmethylacrylamide; N,2-dimethylprop-2-enamide |
Engelse naam |
N-Methyl methacrylamide; N-Methyl methacrylamide; N-Methyl methylacrylamide; N,2-dimethylprop-2-enamide |
MF |
C5H9NO |
Molecuulgewicht |
99.1311 |
InChI |
InChI=1/C5H9NO/c1-4(2)5(7)6-3/h1H2,2-3H3,(H,6,7) |
CAS-nummer |
3887-02-3 |
EINECS |
223-428-1 |
Moleculaire Structuur |
|
Dichtheid |
0.885g/cm3 |
Kookpunt |
219.2°C at 760 mmHg |
Brekingsindex |
1.421 |
Vlampunt |
113.7°C |
Dampdruk |
0.121mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|