ChemNet > CAS > 4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
| Naam product |
5-Acetamido-2-nitrobenzoic acid,98% |
| Synoniemen |
5-(Acetylamino)-2-nitrobenzoic acid; 5-(acetylamino)-2-nitrobenzoate |
| MF |
C9H7N2O5 |
| Molecuulgewicht |
223.1628 |
| InChI |
InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4H,1H3,(H,10,12)(H,13,14)/p-1 |
| CAS-nummer |
4368-83-6 |
| EINECS |
224-461-4 |
| Moleculaire Structuur |
|
| Kookpunt |
522.9°C at 760 mmHg |
| Vlampunt |
270.1°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
