ChemNet > CAS > 4402-83-9 methyl-3-(2,6-dichloorfenyl)-5-methylisoxazol-4-carboxylaat
4402-83-9 methyl-3-(2,6-dichloorfenyl)-5-methylisoxazol-4-carboxylaat
| Naam product |
methyl-3-(2,6-dichloorfenyl)-5-methylisoxazol-4-carboxylaat |
| Synoniemen |
methyl-3-(2,6-dichloorfenyl)-5-methyl-1,2-oxazol-4-carboxylaat |
| Engelse naam |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate;methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| MF |
C12H9Cl2NO3 |
| Molecuulgewicht |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| CAS-nummer |
4402-83-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.37g/cm3 |
| Smeltpunt |
115℃ |
| Kookpunt |
382.4°C at 760 mmHg |
| Brekingsindex |
1.561 |
| Vlampunt |
185.1°C |
| Dampdruk |
4.72E-06mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|