ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
| Naam product |
3-fluoropropiophenone |
| Synoniemen |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| MF |
C9H9FO |
| Molecuulgewicht |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS-nummer |
455-67-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.074g/cm3 |
| Kookpunt |
209.8°C at 760 mmHg |
| Brekingsindex |
1.489 |
| Vlampunt |
79.8°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
