CAS No: 4707-23-7, Chemical Name: benzoic acid, 4-bromo-2,3,5,6-tetrafluoro-, methyl ester
the physical and chemical property of 4707-23-7, benzoic acid, 4-bromo-2,3,5,6-tetrafluoro-, methyl ester is provided by ChemNet.com
ChemNet > CAS > 4707-23-7 benzoic acid, 4-bromo-2,3,5,6-tetrafluoro-, methyl ester
4707-23-7 benzoic acid, 4-bromo-2,3,5,6-tetrafluoro-, methyl ester
Naam product |
benzoic acid, 4-bromo-2,3,5,6-tetrafluoro-, methyl ester |
MF |
C8H3BrF4O2 |
Molecuulgewicht |
287.01 |
InChI |
InChI=1/C8H3BrF4O2/c1-15-8(14)2-4(10)6(12)3(9)7(13)5(2)11/h1H3 |
CAS-nummer |
4707-23-7 |
Moleculaire Structuur |
|
Dichtheid |
1.789g/cm3 |
Kookpunt |
286.8°C at 760 mmHg |
Brekingsindex |
1.481 |
Vlampunt |
127.2°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|