ChemNet > CAS > 488-81-3 Adonitol
488-81-3 Adonitol
Naam product |
Adonitol |
Synoniemen |
Ribitol; Ribit = Ribitol = Adonitol; pentitol; D-ribitol; (2S,4R)-pentane-1,2,3,4,5-pentol |
MF |
C5H12O5 |
Molecuulgewicht |
152.1458 |
InChI |
InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
CAS-nummer |
488-81-3 |
EINECS |
207-685-7 |
Moleculaire Structuur |
|
Dichtheid |
1.525g/cm3 |
Smeltpunt |
101-104℃ |
Kookpunt |
494.5°C at 760 mmHg |
Brekingsindex |
1.57 |
Vlampunt |
261.9°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|