ChemNet > CAS > 491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
Naam product |
4'-Methoxy-3,5,7-trihydroxyflavone |
Synoniemen |
Kaempferide; 3,5,7-Trihydroxy-4-methoxyflavone; 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
MF |
C16H12O6 |
Molecuulgewicht |
300.2629 |
InChI |
InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
CAS-nummer |
491-54-3 |
EINECS |
207-738-4 |
Moleculaire Structuur |
|
Dichtheid |
1.538g/cm3 |
Kookpunt |
543.8°C at 760 mmHg |
Brekingsindex |
1.709 |
Vlampunt |
207.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|