ChemNet > CAS > 499769-96-9 1,3-Benzothiazol-2-ylboronic acid
499769-96-9 1,3-Benzothiazol-2-ylboronic acid
| Naam product |
1,3-Benzothiazol-2-ylboronic acid |
| Synoniemen |
1,3-Benzothiazol-2-Ylboronic Acid,97% |
| MF |
C7H6BNO2S |
| Molecuulgewicht |
179.004 |
| InChI |
InChI=1/C7H6BNO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4,10-11H |
| CAS-nummer |
499769-96-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.441g/cm3 |
| Smeltpunt |
163.6℃ |
| Kookpunt |
388.033°C at 760 mmHg |
| Brekingsindex |
1.677 |
| Vlampunt |
188.476°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
