CAS No: 502-61-4, Chemical Name: 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
the physical and chemical property of 502-61-4, 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- is provided by ChemNet.com
ChemNet > CAS > 502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
Naam product |
1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- |
Synoniemen |
n-Decyl acrylate; 3,7,11-trimethyldodeca-1,3,6,10-tetraene; (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
MF |
C15H24 |
Molecuulgewicht |
204.3511 |
InChI |
InChI=1/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10+,15-12+ |
CAS-nummer |
502-61-4 |
EINECS |
207-948-6 |
Moleculaire Structuur |
|
Dichtheid |
0.812g/cm3 |
Kookpunt |
279.6°C at 760 mmHg |
Brekingsindex |
1.476 |
Vlampunt |
113.2°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|