ChemNet > CAS > 53723-88-9 (5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
53723-88-9 (5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
Naam product |
(5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid |
Synoniemen |
2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetate; [(5-thioxo-4,5-dihydro-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid; [(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid |
MF |
C4H4N2O2S3 |
Molecuulgewicht |
208.2818 |
InChI |
InChI=1/C4H4N2O2S3/c7-2(8)1-10-4-6-5-3(9)11-4/h1H2,(H,5,9)(H,7,8) |
CAS-nummer |
53723-88-9 |
EINECS |
258-728-1 |
Moleculaire Structuur |
|
Dichtheid |
1.89g/cm3 |
Smeltpunt |
158-160℃ |
Kookpunt |
380.6°C at 760 mmHg |
Brekingsindex |
1.85 |
Vlampunt |
184°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S36:Wear suitable protective clothing.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|