ChemNet > CAS > 5411-12-1 1,3-Diphenyl-2,3-epoxy-1-propanone
5411-12-1 1,3-Diphenyl-2,3-epoxy-1-propanone
Naam product |
1,3-Diphenyl-2,3-epoxy-1-propanone |
Synoniemen |
Chalcone alpha,beta-epoxide; Benyzlideneacetophenone epoxide~2-Benzoyl-3-phenyloxirane; phenyl(3-phenyloxiran-2-yl)methanone |
MF |
C15H12O2 |
Molecuulgewicht |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H |
CAS-nummer |
5411-12-1 |
EINECS |
226-487-1 |
Moleculaire Structuur |
|
Dichtheid |
1.209g/cm3 |
Kookpunt |
374.1°C at 760 mmHg |
Brekingsindex |
1.617 |
Vlampunt |
174°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|