5411-58-5 Ethyl-NN-diethyloxamaat
| Naam product |
Ethyl-NN-diethyloxamaat |
| Synoniemen |
5411-58-5; Ethyl(diethylamino)(oxo)acetaat; Ethyldiethyloxamaat; ETHYL-N,N-DIETHYLOXAMAAT; ethyl-NN-diethyloxamaat |
| Engelse naam |
Ethyl NN-Diethyloxamate; 5411-58-5; Ethyl (diethylamino)(oxo)acetate; Ethyl diethyl oxamate; ETHYL N,N-DIETHYLOXAMATE; Ethyl NN-Diethyloxamate |
| MF |
C8H15NO3 |
| Molecuulgewicht |
173.2096 |
| InChI |
InChI=1/C8H15NO3/c1-4-9(5-2)7(10)8(11)12-6-3/h4-6H2,1-3H3 |
| CAS-nummer |
5411-58-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.028g/cm3 |
| Kookpunt |
218.7°C at 760 mmHg |
| Brekingsindex |
1.442 |
| Vlampunt |
86°C |
| Dampdruk |
0.124mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|