ChemNet > CAS > 55620-18-3 2-Acetoxycinnamic acid
55620-18-3 2-Acetoxycinnamic acid
Naam product |
2-Acetoxycinnamic acid |
Synoniemen |
Cinnamic acid, 2-acetoxy-; 3-(2-(Acetyloxy)phenyl)-2-propenoic acid; Cinnamic acid, o-hydroxy-, acetate; NSC 98725; O-Acetyl-o-coumaric acid; Tylmarin; 2-Propenoic acid, 3-(2-(acetyloxy)phenyl)- (9CI) |
MF |
C11H10O4 |
Molecuulgewicht |
206.19
|
InChI |
InChI=1/C11H10O4/c1-8(12)15-10-5-3-2-4-9(10)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ |
CAS-nummer |
55620-18-3 |
Moleculaire Structuur |
|
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|