ChemNet > CAS > 570-02-5 2,4,6-Trimethoxybenzoic acid
570-02-5 2,4,6-Trimethoxybenzoic acid
| Naam product |
2,4,6-Trimethoxybenzoic acid |
| Synoniemen |
Benzoic acid, 2,4,6-trimethoxy- |
| MF |
C10H12O5 |
| Molecuulgewicht |
212.1993 |
| InChI |
InChI=1/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
| CAS-nummer |
570-02-5 |
| EINECS |
209-325-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.219g/cm3 |
| Kookpunt |
350.6°C at 760 mmHg |
| Brekingsindex |
1.523 |
| Vlampunt |
137.4°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
