ChemNet > CAS > 576-82-9 5-fluor-1,2,3-tribroombenzeen
576-82-9 5-fluor-1,2,3-tribroombenzeen
Naam product |
5-fluor-1,2,3-tribroombenzeen |
Synoniemen |
1,2,3-tribroom-5-fluorobenzeen |
Engelse naam |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
MF |
C6H2Br3F |
Molecuulgewicht |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS-nummer |
576-82-9 |
Moleculaire Structuur |
|
Dichtheid |
2.34g/cm3 |
Kookpunt |
274.2°C at 760 mmHg |
Brekingsindex |
1.61 |
Vlampunt |
119.6°C |
Dampdruk |
0.0092mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|