ChemNet > CAS > 5933-32-4 4-Bromobenzhydrazide
5933-32-4 4-Bromobenzhydrazide
Naam product |
4-Bromobenzhydrazide |
Synoniemen |
4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
MF |
C7H7BrN2O |
Molecuulgewicht |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS-nummer |
5933-32-4 |
EINECS |
227-681-9 |
Moleculaire Structuur |
|
Dichtheid |
1.615g/cm3 |
Smeltpunt |
165-167℃ |
Kookpunt |
353.2°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
167.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|