ChemNet > CAS > 610-34-4 Ethyl 2-nitrobenzoate
610-34-4 Ethyl 2-nitrobenzoate
Naam product |
Ethyl 2-nitrobenzoate |
Synoniemen |
2-Nitrobenzoic acid ethyl ester |
MF |
C9H9NO4 |
Molecuulgewicht |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
CAS-nummer |
610-34-4 |
EINECS |
210-220-0 |
Moleculaire Structuur |
|
Dichtheid |
1.253g/cm3 |
Smeltpunt |
26-174℃ |
Kookpunt |
275°C at 760 mmHg |
Brekingsindex |
1.544 |
Vlampunt |
126.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|