610-69-5 2-nitrofenylacetaat
Naam product |
2-nitrofenylacetaat |
Synoniemen |
2-nitrofenylacetaat; Azijnzuur-2-nitrofenylester |
Engelse naam |
2-nitrophenyl acetate; 2-Nitrophenyl acetate; Acetic acid 2-nitrophenyl ester |
MF |
C8H7NO4 |
Molecuulgewicht |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS-nummer |
610-69-5 |
EINECS |
210-233-1 |
Moleculaire Structuur |
|
Dichtheid |
1.304g/cm3 |
Smeltpunt |
39-41℃ |
Kookpunt |
274.8°C at 760 mmHg |
Brekingsindex |
1.548 |
Vlampunt |
139.8°C |
Dampdruk |
0.00528mmHg at 25°C |
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|