ChemNet > CAS > 61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
Naam product |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
Synoniemen |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylate |
MF |
C12H11N2O2 |
Molecuulgewicht |
215.2285 |
InChI |
InChI=1/C12H12N2O2/c1-8-11(12(15)16)9(2)14(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16)/p-1 |
CAS-nummer |
61226-19-5 |
Moleculaire Structuur |
|
Smeltpunt |
202℃ |
Kookpunt |
387.7°C at 760 mmHg |
Vlampunt |
188.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|