ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
Naam product |
2,5-Dihydroxy-1,4-benzoquinone |
Synoniemen |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
MF |
C6H4O4 |
Molecuulgewicht |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
CAS-nummer |
615-94-1 |
EINECS |
210-454-3 |
Moleculaire Structuur |
|
Dichtheid |
1.843g/cm3 |
Smeltpunt |
220℃ |
Kookpunt |
322.3°C at 760 mmHg |
Brekingsindex |
1.729 |
Vlampunt |
162.9°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|