ChemNet > CAS > 617-36-7 Ethyl oxamate
617-36-7 Ethyl oxamate
| Naam product |
Ethyl oxamate |
| Synoniemen |
oxamethane; Oxamic acid ethyl ester; ethyl amino(oxo)acetate |
| MF |
C4H7NO3 |
| Molecuulgewicht |
117.1033 |
| InChI |
InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
| CAS-nummer |
617-36-7 |
| EINECS |
210-512-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.184g/cm3 |
| Smeltpunt |
112-115℃ |
| Kookpunt |
188.7°C at 760 mmHg |
| Brekingsindex |
1.437 |
| Vlampunt |
87°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
