ChemNet > CAS > 617-36-7 Ethyl oxamate
617-36-7 Ethyl oxamate
Naam product |
Ethyl oxamate |
Synoniemen |
oxamethane; Oxamic acid ethyl ester; ethyl amino(oxo)acetate |
MF |
C4H7NO3 |
Molecuulgewicht |
117.1033 |
InChI |
InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
CAS-nummer |
617-36-7 |
EINECS |
210-512-8 |
Moleculaire Structuur |
|
Dichtheid |
1.184g/cm3 |
Smeltpunt |
112-115℃ |
Kookpunt |
188.7°C at 760 mmHg |
Brekingsindex |
1.437 |
Vlampunt |
87°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|