ChemNet > CAS > 6214-44-4 4-Ethoxybenzyl alcohol
6214-44-4 4-Ethoxybenzyl alcohol
Naam product |
4-Ethoxybenzyl alcohol |
Synoniemen |
AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
MF |
C9H12O2 |
Molecuulgewicht |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
CAS-nummer |
6214-44-4 |
EINECS |
228-283-8 |
Moleculaire Structuur |
|
Dichtheid |
1.058g/cm3 |
Smeltpunt |
27-32℃ |
Kookpunt |
273°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
114.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|