ChemNet > CAS > 623-98-3 Di-n-propyl sulphite
623-98-3 Di-n-propyl sulphite
Naam product |
Di-n-propyl sulphite |
MF |
C6H14O3S |
Molecuulgewicht |
166.23 |
InChI |
InChI=1/C6H14O3S/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3 |
CAS-nummer |
623-98-3 |
Moleculaire Structuur |
|
Dichtheid |
1.03 |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|