ChemNet > CAS > 62484-76-8 5,7-dimethylchromon-3-carboxaldehyde
62484-76-8 5,7-dimethylchromon-3-carboxaldehyde
Naam product |
5,7-dimethylchromon-3-carboxaldehyde |
Synoniemen |
5,7-dimethyl-4-oxo-4H-chroom-3-carbaldehyde |
Engelse naam |
5,7-Dimethylchromone-3-carboxaldehyde;5,7-dimethyl-4-oxo-4H-chromene-3-carbaldehyde |
MF |
C12H10O3 |
Molecuulgewicht |
202.206 |
InChI |
InChI=1/C12H10O3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-6H,1-2H3 |
CAS-nummer |
62484-76-8 |
Moleculaire Structuur |
|
Dichtheid |
1.311g/cm3 |
Kookpunt |
362.7°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
163.2°C |
Dampdruk |
1.9E-05mmHg at 25°C |
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|