ChemNet > CAS > 6324-11-4 (2-hydroxyphenoxy)acetic acid
6324-11-4 (2-hydroxyphenoxy)acetic acid
Naam product |
(2-hydroxyphenoxy)acetic acid |
Synoniemen |
2-Hydroxyphenoxyacetic acid |
MF |
C8H8O4 |
Molecuulgewicht |
168.1467 |
InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
CAS-nummer |
6324-11-4 |
EINECS |
228-684-8 |
Moleculaire Structuur |
|
Dichtheid |
1.367g/cm3 |
Smeltpunt |
138-141℃ |
Kookpunt |
339.6°C at 760 mmHg |
Brekingsindex |
1.581 |
Vlampunt |
143°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|