ChemNet > CAS > 6344-60-1 1-Hydroxy-9-fluorenone
6344-60-1 1-Hydroxy-9-fluorenone
Naam product |
1-Hydroxy-9-fluorenone |
Synoniemen |
1-Hydroxyfluoren-9-one; 1-hydroxy-9H-fluoren-9-one |
MF |
C13H8O2 |
Molecuulgewicht |
196.2014 |
InChI |
InChI=1/C13H8O2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7,14H |
CAS-nummer |
6344-60-1 |
EINECS |
228-746-4 |
Moleculaire Structuur |
|
Dichtheid |
1.369g/cm3 |
Smeltpunt |
116-119℃ |
Kookpunt |
383.4°C at 760 mmHg |
Brekingsindex |
1.707 |
Vlampunt |
163.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|