ChemNet > CAS > 66085-00-5 isooctadecaanzuur, monoester met glycerol
66085-00-5 isooctadecaanzuur, monoester met glycerol
| Naam product |
isooctadecaanzuur, monoester met glycerol |
| Synoniemen |
Glycerylisostearaat; Glyceryl monoisostearaat; Isooctadecaanzuur, monoester met 1,2,3-propaantriol; Glycerol monoisostearaat; Isostearinezuur, 1,2,3-propaanolester (1:1); Isooctadecaanzuur, monoester met glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl-16-methylheptadecanoaat |
| Engelse naam |
isooctadecanoic acid, monoester with glycerol; Glyceryl isostearate; Glyceryl monoisostearate; Isooctadecanoic acid, monoester with 1,2,3-propanetriol; Glycerol monoisostearate; Isostearic acid, 1,2,3-propaneriol ester (1:1); Isooctadecanoic acid, monoester with glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl 16-methylheptadecanoate; Glyceryl lsostearate |
| MF |
C21H42O4 |
| Molecuulgewicht |
358.5558 |
| InChI |
InChI=1/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-20(17-22)18-23/h19-20,22-23H,3-18H2,1-2H3 |
| CAS-nummer |
66085-00-5 |
| EINECS |
266-124-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.957g/cm3 |
| Kookpunt |
481.5°C at 760 mmHg |
| Brekingsindex |
1.468 |
| Vlampunt |
153.8°C |
| Dampdruk |
2.7E-11mmHg at 25°C |
|