ChemNet > CAS > 67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
Naam product |
4-Chloro-5-nitro-o-phenylenediamine |
Synoniemen |
4-chloro-5-nitrobenzene-1,2-diamine |
MF |
C6H6ClN3O2 |
Molecuulgewicht |
187.5837 |
InChI |
InChI=1/C6H6ClN3O2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H,8-9H2 |
CAS-nummer |
67073-39-6 |
Moleculaire Structuur |
|
Dichtheid |
1.592g/cm3 |
Smeltpunt |
189℃ |
Kookpunt |
458.9°C at 760 mmHg |
Brekingsindex |
1.712 |
Vlampunt |
231.3°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|