CAS No: 74472-47-2, Chemical Name: 2,2',3,4,4',5,6-heptachlorobiphenyl
the physical and chemical property of 74472-47-2, 2,2',3,4,4',5,6-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 74472-47-2 2,2',3,4,4',5,6-heptachlorobiphenyl
74472-47-2 2,2',3,4,4',5,6-heptachlorobiphenyl
Naam product |
2,2',3,4,4',5,6-heptachlorobiphenyl |
Synoniemen |
1,1'-biphenyl, 2,2',3,4,4',5,6-heptachloro-; 2,2',3,4,4',5,6-Heptachloro-1,1'-biphenyl; 2,2',3,4,4',5,6-PCB; 74472-47-2 |
MF |
C12H3Cl7 |
Molecuulgewicht |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-4-1-2-5(6(14)3-4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
CAS-nummer |
74472-47-2 |
Moleculaire Structuur |
|
Dichtheid |
1.658g/cm3 |
Kookpunt |
407.3°C at 760 mmHg |
Brekingsindex |
1.632 |
Vlampunt |
198.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|