CAS No: 76263-11-1, Chemical Name: ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
the physical and chemical property of 76263-11-1, ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate is provided by ChemNet.com
ChemNet > CAS > 76263-11-1 ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
76263-11-1 ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate
| Naam product |
ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate |
| Synoniemen |
4-Benzothiazolecarboxylic acid, 2-amino-4,5,6,7-tetrahydro-, ethyl ester; Ethyl 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate; ETHYL 2-AMINO-4,5,6,7-TETRAHYDROBENZOTHIAZOLE-4-CARBOXYLATE |
| MF |
C10H14N2O2S |
| Molecuulgewicht |
226.2954 |
| InChI |
InChI=1/C10H14N2O2S/c1-2-14-9(13)6-4-3-5-7-8(6)12-10(11)15-7/h6H,2-5H2,1H3,(H2,11,12) |
| CAS-nummer |
76263-11-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.29g/cm3 |
| Kookpunt |
381.014°C at 760 mmHg |
| Brekingsindex |
1.592 |
| Vlampunt |
184.231°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
