CAS No: 76282-33-2, Chemical Name: 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
the physical and chemical property of 76282-33-2, 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane is provided by ChemNet.com
ChemNet > CAS > 76282-33-2 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
76282-33-2 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
Naam product |
1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane |
Synoniemen |
Tetraazatetramethyl-12-crown-4 |
MF |
C12H28N4 |
Molecuulgewicht |
228.3775 |
InChI |
InChI=1/C12H28N4/c1-13-5-7-14(2)9-11-16(4)12-10-15(3)8-6-13/h5-12H2,1-4H3 |
CAS-nummer |
76282-33-2 |
Moleculaire Structuur |
|
Dichtheid |
0.888g/cm3 |
Kookpunt |
281.6°C at 760 mmHg |
Brekingsindex |
1.456 |
Vlampunt |
109.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|