ChemNet > CAS > 76410-58-7 4-Borono-L-fenylalanine
76410-58-7 4-Borono-L-fenylalanine
| Naam product |
4-Borono-L-fenylalanine |
| Synoniemen |
4-Boronopfenylalanine; 10B-Bpa; para-Borono-L-fenylalanine; para-boronofenylalanine; L-fenylalanine, 4-borono-; 4-(dihydroxyboranyl)fenylalanine; 4-(dihydroxyboranyl)-L-fenylalanine |
| Engelse naam |
4-Borono-L-phenylalanine;4-Boronophenylalanine; 10B-Bpa; para-Borono-L-phenylalanine; para-Boronophenylalanine; L-Phenylalanine, 4-borono-; 4-(dihydroxyboranyl)phenylalanine; 4-(dihydroxyboranyl)-L-phenylalanine |
| MF |
C9H12BNO4 |
| Molecuulgewicht |
209.0069 |
| InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
| CAS-nummer |
76410-58-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.34g/cm3 |
| Kookpunt |
449.3°C at 760 mmHg |
| Brekingsindex |
1.59 |
| Vlampunt |
225.5°C |
| Dampdruk |
7.39E-09mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|