ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
Naam product |
methyl pentafluorobenzene |
Synoniemen |
2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
MF |
C7H3F5 |
Molecuulgewicht |
182.09 |
InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
CAS-nummer |
771-56-2 |
EINECS |
212-233-7 |
Moleculaire Structuur |
|
Dichtheid |
1.44 |
Kookpunt |
117℃ |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|