ChemNet > CAS > 82228-89-5 4-formyl-1-methylpyridinium benzenesulfo nate
82228-89-5 4-formyl-1-methylpyridinium benzenesulfo nate
Naam product |
4-formyl-1-methylpyridinium benzenesulfo nate |
Synoniemen |
4-Formyl-1-methylpyridinium benzenesulfonate; pyridinium, 4-formyl-1-methyl- benzenesulfonate (1:1) |
MF |
C13H13NO4S |
Molecuulgewicht |
279.3116 |
InChI |
InChI=1/C7H8NO.C6H6O3S/c1-8-4-2-7(6-9)3-5-8;7-10(8,9)6-4-2-1-3-5-6/h2-6H,1H3;1-5H,(H,7,8,9)/q+1;/p-1 |
CAS-nummer |
82228-89-5 |
Moleculaire Structuur |
|
Smeltpunt |
95℃ |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|