ChemNet > CAS > 84852-15-3 4-nonyl phenol
84852-15-3 4-nonyl phenol
| Naam product |
4-nonyl phenol |
| Synoniemen |
Branched p-nonylphenol; C9 branched alkyl phenol; p-Nonylphenol; p-Nonylphenol, branched; Phenol,4-nonyl-,branched; 4-(7-methyloctyl)phenol |
| MF |
C15H24O |
| Molecuulgewicht |
220.3505 |
| InChI |
InChI=1/C15H24O/c1-13(2)7-5-3-4-6-8-14-9-11-15(16)12-10-14/h9-13,16H,3-8H2,1-2H3 |
| CAS-nummer |
84852-15-3 |
| EINECS |
284-325-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.931g/cm3 |
| Kookpunt |
325.3°C at 760 mmHg |
| Brekingsindex |
1.504 |
| Vlampunt |
167.8°C |
| Oplosbaarheid in water |
5g/L |
| Gevaarsymbolen |
 C:Corrosive;
 N:Dangerous for the environment;
|
| Risico-codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
